- Treffer 1 von 1
Immunoactive ionic liquids based on 2-hydroxyethylamines and 1-R-indol-3-ylsulfanylacetic acids. Crystal and molecular structure of immunodepressant tris-(2-hydroxyethyl)ammonium indol-3-ylsulfanylacetate
- Immunoactive ionic liquids (2-hydroxyethyl) ammonium 1-R-indol-3-ylsulfanyl-acetates HN+R1R2(CH2CH2OH)center dot O-(O)CCH2S-Ind-R-3-1(1-5), were synthesized by the reaction of (2-hydroxyethyl)amines with indol-3-ylsulfanylacetic- or 1-benzylindol-3-ylsulfanylacetic acid. 1: R-1 = R-2 = CH2CH2OH, R-3 = H; 2: R-1 =CH3, R-2=CH2CH2OH, R3 = H; 3: R-1 = R-2 = CH3, R-3 = H; 4: R-1 = R-2 = CH2CH2OH, R-3 = CH2C6H5; 5: R-1 = CH3; R-2 = CH2CH2OH; R-3 = CH2C6H5. The structure of each compound was elucidated by IR, NMR H-1, C-13, and N-15 techniques and their composition was confirmed by elemental analysis. The crystal structure of tris-(2-hydroxyethyl) ammonium indol-3-ylsulfanylacetate was investigated by X-ray diffraction analysis. Immunoactive properties of the title compounds were screened.
| Verfasserangaben: | Anna N. Mirskova, Sergey N. Adamovich, Rudolf G. Mirskov, Olga P. Kolesnikova, Uwe SchildeORCiDGND |
|---|---|
| DOI: | https://doi.org/10.1515/chem-2015-0018 |
| ISSN: | 2391-5420 |
| Titel des übergeordneten Werks (Englisch): | Open chemistry : formerly Central European journal of chemistry |
| Verlag: | De Gruyter Open |
| Verlagsort: | Warsaw |
| Publikationstyp: | Wissenschaftlicher Artikel |
| Sprache: | Englisch |
| Jahr der Erstveröffentlichung: | 2015 |
| Erscheinungsjahr: | 2015 |
| Datum der Freischaltung: | 27.03.2017 |
| Freies Schlagwort / Tag: | 2-Hydroxyethylammonium 1-R-indol-3-ylsulfanylacetates; Crystal and molecular structure; Immunoactive properties; Protic 2-hydroxyethylammonium ionic liquids |
| Band: | 13 |
| Ausgabe: | 1 |
| Seitenanzahl: | 7 |
| Erste Seite: | 149 |
| Letzte Seite: | 155 |
| Fördernde Institution: | Presidium of Russian Academy of Sciences |
| Organisationseinheiten: | Mathematisch-Naturwissenschaftliche Fakultät / Institut für Chemie |
| Peer Review: | Referiert |
| Publikationsweg: | Open Access |
