Immunoactive ionic liquids based on 2-hydroxyethylamines and 1-R-indol-3-ylsulfanylacetic acids. Crystal and molecular structure of immunodepressant tris-(2-hydroxyethyl)ammonium indol-3-ylsulfanylacetate
- Immunoactive ionic liquids (2-hydroxyethyl) ammonium 1-R-indol-3-ylsulfanyl-acetates HN+R1R2(CH2CH2OH)center dot O-(O)CCH2S-Ind-R-3-1(1-5), were synthesized by the reaction of (2-hydroxyethyl)amines with indol-3-ylsulfanylacetic- or 1-benzylindol-3-ylsulfanylacetic acid. 1: R-1 = R-2 = CH2CH2OH, R-3 = H; 2: R-1 =CH3, R-2=CH2CH2OH, R3 = H; 3: R-1 = R-2 = CH3, R-3 = H; 4: R-1 = R-2 = CH2CH2OH, R-3 = CH2C6H5; 5: R-1 = CH3; R-2 = CH2CH2OH; R-3 = CH2C6H5. The structure of each compound was elucidated by IR, NMR H-1, C-13, and N-15 techniques and their composition was confirmed by elemental analysis. The crystal structure of tris-(2-hydroxyethyl) ammonium indol-3-ylsulfanylacetate was investigated by X-ray diffraction analysis. Immunoactive properties of the title compounds were screened.
Author details: | Anna N. Mirskova, Sergey N. Adamovich, Rudolf G. Mirskov, Olga P. Kolesnikova, Uwe SchildeORCiDGND |
---|---|
DOI: | https://doi.org/10.1515/chem-2015-0018 |
ISSN: | 2391-5420 |
Title of parent work (English): | Open chemistry : formerly Central European journal of chemistry |
Publisher: | De Gruyter Open |
Place of publishing: | Warsaw |
Publication type: | Article |
Language: | English |
Year of first publication: | 2015 |
Publication year: | 2015 |
Release date: | 2017/03/27 |
Tag: | 2-Hydroxyethylammonium 1-R-indol-3-ylsulfanylacetates; Crystal and molecular structure; Immunoactive properties; Protic 2-hydroxyethylammonium ionic liquids |
Volume: | 13 |
Issue: | 1 |
Number of pages: | 7 |
First page: | 149 |
Last Page: | 155 |
Funding institution: | Presidium of Russian Academy of Sciences |
Organizational units: | Mathematisch-Naturwissenschaftliche Fakultät / Institut für Chemie |
Peer review: | Referiert |
Publishing method: | Open Access |