Refine
Has Fulltext
- no (1) (remove)
Year of publication
- 2015 (1)
Document Type
- Article (1) (remove)
Language
- English (1)
Is part of the Bibliography
- yes (1)
Keywords
- Protic 2-hydroxyethylammonium ionic liquids (1) (remove)
Institute
- Institut für Chemie (1) (remove)
Immunoactive ionic liquids (2-hydroxyethyl) ammonium 1-R-indol-3-ylsulfanyl-acetates HN+R1R2(CH2CH2OH)center dot O-(O)CCH2S-Ind-R-3-1(1-5), were synthesized by the reaction of (2-hydroxyethyl)amines with indol-3-ylsulfanylacetic- or 1-benzylindol-3-ylsulfanylacetic acid. 1: R-1 = R-2 = CH2CH2OH, R-3 = H; 2: R-1 =CH3, R-2=CH2CH2OH, R3 = H; 3: R-1 = R-2 = CH3, R-3 = H; 4: R-1 = R-2 = CH2CH2OH, R-3 = CH2C6H5; 5: R-1 = CH3; R-2 = CH2CH2OH; R-3 = CH2C6H5. The structure of each compound was elucidated by IR, NMR H-1, C-13, and N-15 techniques and their composition was confirmed by elemental analysis. The crystal structure of tris-(2-hydroxyethyl) ammonium indol-3-ylsulfanylacetate was investigated by X-ray diffraction analysis. Immunoactive properties of the title compounds were screened.