TY  - JOUR
A1  - Mirskova, Anna N.
A1  - Adamovich, Sergey N.
A1  - Mirskov, Rudolf G.
A1  - Kolesnikova, Olga P.
A1  - Schilde, Uwe
T1  - Immunoactive ionic liquids based on 2-hydroxyethylamines and 1-R-indol-3-ylsulfanylacetic acids. Crystal and molecular structure of immunodepressant tris-(2-hydroxyethyl)ammonium indol-3-ylsulfanylacetate
JF  - Open chemistry : formerly Central European journal of chemistry
N2  - Immunoactive ionic liquids (2-hydroxyethyl) ammonium 1-R-indol-3-ylsulfanyl-acetates HN+R1R2(CH2CH2OH)center dot O-(O)CCH2S-Ind-R-3-1(1-5), were synthesized by the reaction of (2-hydroxyethyl)amines with indol-3-ylsulfanylacetic- or 1-benzylindol-3-ylsulfanylacetic acid. 1: R-1 = R-2 = CH2CH2OH, R-3 = H; 2: R-1 =CH3, R-2=CH2CH2OH, R3 = H; 3: R-1 = R-2 = CH3, R-3 = H; 4: R-1 = R-2 = CH2CH2OH, R-3 = CH2C6H5; 5: R-1 = CH3; R-2 = CH2CH2OH; R-3 = CH2C6H5. The structure of each compound was elucidated by IR, NMR H-1, C-13, and N-15 techniques and their composition was confirmed by elemental analysis. The crystal structure of tris-(2-hydroxyethyl) ammonium indol-3-ylsulfanylacetate was investigated by X-ray diffraction analysis. Immunoactive properties of the title compounds were screened.
KW  - Protic 2-hydroxyethylammonium ionic liquids
KW  - 2-Hydroxyethylammonium 1-R-indol-3-ylsulfanylacetates
KW  - Crystal and molecular structure
KW  - Immunoactive properties
Y1  - 2015
U6  - https://doi.org/10.1515/chem-2015-0018
SN  - 2391-5420
VL  - 13
IS  - 1
SP  - 149
EP  - 155
PB  - De Gruyter Open
CY  - Warsaw
ER  -