@article{MirskovaAdamovichMirskovetal.2015,
  author    = {Mirskova, Anna N. and Adamovich, Sergey N. and Mirskov, Rudolf G. and Kolesnikova, Olga P. and Schilde, Uwe},
  title     = {Immunoactive ionic liquids based on 2-hydroxyethylamines and 1-R-indol-3-ylsulfanylacetic acids. Crystal and molecular structure of immunodepressant tris-(2-hydroxyethyl)ammonium indol-3-ylsulfanylacetate},
  series = {Open chemistry : formerly Central European journal of chemistry},
  volume    = {13},
  journal   = {Open chemistry : formerly Central European journal of chemistry},
  number    = {1},
  publisher = {De Gruyter Open},
  address   = {Warsaw},
  issn      = {2391-5420},
  doi       = {10.1515/chem-2015-0018},
  pages     = {149 -- 155},
  year      = {2015},
  abstract  = {Immunoactive ionic liquids (2-hydroxyethyl) ammonium 1-R-indol-3-ylsulfanyl-acetates HN+R1R2(CH2CH2OH)center dot O-(O)CCH2S-Ind-R-3-1(1-5), were synthesized by the reaction of (2-hydroxyethyl)amines with indol-3-ylsulfanylacetic- or 1-benzylindol-3-ylsulfanylacetic acid. 1: R-1 = R-2 = CH2CH2OH, R-3 = H; 2: R-1 =CH3, R-2=CH2CH2OH, R3 = H; 3: R-1 = R-2 = CH3, R-3 = H; 4: R-1 = R-2 = CH2CH2OH, R-3 = CH2C6H5; 5: R-1 = CH3; R-2 = CH2CH2OH; R-3 = CH2C6H5. The structure of each compound was elucidated by IR, NMR H-1, C-13, and N-15 techniques and their composition was confirmed by elemental analysis. The crystal structure of tris-(2-hydroxyethyl) ammonium indol-3-ylsulfanylacetate was investigated by X-ray diffraction analysis. Immunoactive properties of the title compounds were screened.},
  language  = {en}
}